C21H31NO11 — CID 67534478
(2R,3R,4R,5R)-2,3,5,6-tetrahydroxy-N-(1-phenylprop-2-enyl)-4-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexanamide (PubChem CID 67534478) has the molecular formula C21H31NO11 and a molecular weight of 473.48 g/mol. Its IUPAC name is (2R,3R,4R,5R)-2,3,5,6-tetrahydroxy-N-(1-phenylprop-2-enyl)-4-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexanamide.
| Compound Name | (2R,3R,4R,5R)-2,3,5,6-tetrahydroxy-N-(1-phenylprop-2-enyl)-4-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexanamide |
|---|---|
| PubChem CID | 67534478 |
| Molecular Formula | C21H31NO11 |
| Molecular Weight | 473.48 g/mol |
| Exact Mass | 473.19 |
| IUPAC Name | (2R,3R,4R,5R)-2,3,5,6-tetrahydroxy-N-(1-phenylprop-2-enyl)-4-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexanamide |
| SMILES | C=CC(NC(=O)[C@H](O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O)[C@H](O)CO)c1ccccc1 |
| InChI | InChI=1S/C21H31NO11/c1-2-11(10-6-4-3-5-7-10)22-20(31)17(29)16(28)19(12(25)8-23)33-21-18(30)15(27)14(26)13(9-24)32-21/h2-7,11-19,21,23-30H,1,8-9H2,(H,22,31)/t11?,12-,13-,14+,15+,16-,17-,18-,19-,21+/m1/s1 |
| InChIKey | UGPCBRVDWFFKLG-OTBYZGPQSA-N |
| XLogP | -3.71 |
| TPSA | 209.40 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.48 |
| LogP ≤ 5 | -3.71 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|