About (Z)-1-N'-ethyl-1-N'-[(2-fluoro-1,3-thiazol-5-yl)methyl]-1-N-methyl-2-nitroethene-1,1-diamine
(Z)-1-N'-ethyl-1-N'-[(2-fluoro-1,3-thiazol-5-yl)methyl]-1-N-methyl-2-nitroethene-1,1-diamine (PubChem CID 67534518) has the molecular formula C9H13FN4O2S
and a molecular weight of 260.29 g/mol. Its IUPAC name is (Z)-1-N'-ethyl-1-N'-[(2-fluoro-1,3-thiazol-5-yl)methyl]-1-N-methyl-2-nitroethene-1,1-diamine.
Molecular Properties
| Compound Name | (Z)-1-N'-ethyl-1-N'-[(2-fluoro-1,3-thiazol-5-yl)methyl]-1-N-methyl-2-nitroethene-1,1-diamine |
| PubChem CID | 67534518 |
| Molecular Formula | C9H13FN4O2S |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.07 |
| IUPAC Name | (Z)-1-N'-ethyl-1-N'-[(2-fluoro-1,3-thiazol-5-yl)methyl]-1-N-methyl-2-nitroethene-1,1-diamine |
| SMILES | CCN(Cc1cnc(F)s1)/C(=C\[N+](=O)[O-])NC |
| InChI | InChI=1S/C9H13FN4O2S/c1-3-13(8(11-2)6-14(15)16)5-7-4-12-9(10)17-7/h4,6,11H,3,5H2,1-2H3/b8-6- |
| InChIKey | SLUNZPBIVKARID-VURMDHGXSA-N |
| XLogP | 1.40 |
| TPSA | 71.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (Z)-1-N'-ethyl-1-N'-[(2-fluoro-1,3-thiazol-5-yl)methyl]-1-N-methyl-2-nitroethene-1,1-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-1-N'-ethyl-1-N'-[(2-fluoro-1,3-thiazol-5-yl)methyl]-1-N-methyl-2-nitroethene-1,1-diamine?
The IUPAC name of (Z)-1-N'-ethyl-1-N'-[(2-fluoro-1,3-thiazol-5-yl)methyl]-1-N-methyl-2-nitroethene-1,1-diamine (CID 67534518) is (Z)-1-N'-ethyl-1-N'-[(2-fluoro-1,3-thiazol-5-yl)methyl]-1-N-methyl-2-nitroethene-1,1-diamine.
What is the SMILES notation for (Z)-1-N'-ethyl-1-N'-[(2-fluoro-1,3-thiazol-5-yl)methyl]-1-N-methyl-2-nitroethene-1,1-diamine?
The canonical SMILES for (Z)-1-N'-ethyl-1-N'-[(2-fluoro-1,3-thiazol-5-yl)methyl]-1-N-methyl-2-nitroethene-1,1-diamine is CCN(Cc1cnc(F)s1)/C(=C\[N+](=O)[O-])NC.
What is the InChIKey of (Z)-1-N'-ethyl-1-N'-[(2-fluoro-1,3-thiazol-5-yl)methyl]-1-N-methyl-2-nitroethene-1,1-diamine?
The InChIKey is SLUNZPBIVKARID-VURMDHGXSA-N. The full InChI is InChI=1S/C9H13FN4O2S/c1-3-13(8(11-2)6-14(15)16)5-7-4-12-9(10)17-7/h4,6,11H,3,5H2,1-2H3/b8-6-.
What are the key properties of (Z)-1-N'-ethyl-1-N'-[(2-fluoro-1,3-thiazol-5-yl)methyl]-1-N-methyl-2-nitroethene-1,1-diamine?
(Z)-1-N'-ethyl-1-N'-[(2-fluoro-1,3-thiazol-5-yl)methyl]-1-N-methyl-2-nitroethene-1,1-diamine has a molecular weight of 260.29 g/mol, XLogP of 1.40, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-1-N'-ethyl-1-N'-[(2-fluoro-1,3-thiazol-5-yl)methyl]-1-N-methyl-2-nitroethene-1,1-diamine is sourced from PubChem (CID 67534518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).