C25H34N2O5 — CID 67534948
diethyl carbonate;(R)-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol (PubChem CID 67534948) has the molecular formula C25H34N2O5 and a molecular weight of 442.56 g/mol. Its IUPAC name is diethyl carbonate;(R)-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol.
| Compound Name | diethyl carbonate;(R)-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol |
|---|---|
| PubChem CID | 67534948 |
| Molecular Formula | C25H34N2O5 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.25 |
| IUPAC Name | diethyl carbonate;(R)-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol |
| SMILES | C=C[C@H]1CN2CC[C@H]1C[C@H]2[C@H](O)c1ccnc2ccc(OC)cc12.CCOC(=O)OCC |
| InChI | InChI=1S/C20H24N2O2.C5H10O3/c1-3-13-12-22-9-7-14(13)10-19(22)20(23)16-6-8-21-18-5-4-15(24-2)11-17(16)18;1-3-7-5(6)8-4-2/h3-6,8,11,13-14,19-20,23H,1,7,9-10,12H2,2H3;3-4H2,1-2H3/t13-,14-,19-,20+;/m0./s1 |
| InChIKey | DNSWOJDDPKVMGY-DSXUQNDKSA-N |
| XLogP | 4.35 |
| TPSA | 81.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|