About acetic acid;1-tritylimidazole
acetic acid;1-tritylimidazole (PubChem CID 67535266) has the molecular formula C24H22N2O2
and a molecular weight of 370.45 g/mol. Its IUPAC name is acetic acid;1-tritylimidazole.
Molecular Properties
| Compound Name | acetic acid;1-tritylimidazole |
| PubChem CID | 67535266 |
| Molecular Formula | C24H22N2O2 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | acetic acid;1-tritylimidazole |
| SMILES | CC(=O)O.c1ccc(C(c2ccccc2)(c2ccccc2)n2ccnc2)cc1 |
| InChI | InChI=1S/C22H18N2.C2H4O2/c1-4-10-19(11-5-1)22(24-17-16-23-18-24,20-12-6-2-7-13-20)21-14-8-3-9-15-21;1-2(3)4/h1-18H;1H3,(H,3,4) |
| InChIKey | MYEGUJUQWBFLML-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze acetic acid;1-tritylimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;1-tritylimidazole?
The IUPAC name of acetic acid;1-tritylimidazole (CID 67535266) is acetic acid;1-tritylimidazole.
What is the SMILES notation for acetic acid;1-tritylimidazole?
The canonical SMILES for acetic acid;1-tritylimidazole is CC(=O)O.c1ccc(C(c2ccccc2)(c2ccccc2)n2ccnc2)cc1.
What is the InChIKey of acetic acid;1-tritylimidazole?
The InChIKey is MYEGUJUQWBFLML-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H18N2.C2H4O2/c1-4-10-19(11-5-1)22(24-17-16-23-18-24,20-12-6-2-7-13-20)21-14-8-3-9-15-21;1-2(3)4/h1-18H;1H3,(H,3,4).
What are the key properties of acetic acid;1-tritylimidazole?
acetic acid;1-tritylimidazole has a molecular weight of 370.45 g/mol, XLogP of 4.81, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;1-tritylimidazole is sourced from PubChem (CID 67535266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).