C10H15N — CID 67535755
4,6,7,8,9,9a-hexahydro-3H-2-benzazepine (PubChem CID 67535755) has the molecular formula C10H15N and a molecular weight of 149.24 g/mol. Its IUPAC name is 4,6,7,8,9,9a-hexahydro-3H-2-benzazepine.
| Compound Name | 4,6,7,8,9,9a-hexahydro-3H-2-benzazepine |
|---|---|
| PubChem CID | 67535755 |
| Molecular Formula | C10H15N |
| Molecular Weight | 149.24 g/mol |
| Exact Mass | 149.12 |
| IUPAC Name | 4,6,7,8,9,9a-hexahydro-3H-2-benzazepine |
| SMILES | C1=NCCC=C2CCCCC12 |
| InChI | InChI=1S/C10H15N/c1-2-5-10-8-11-7-3-6-9(10)4-1/h6,8,10H,1-5,7H2 |
| InChIKey | RUPITKRRIOKVGC-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.24 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|