C34H44BF2N3O6 — CID 67535872
[4-[3-[4,7-difluoro-1-(3-methoxypropyl)indol-2-yl]piperidin-1-yl]-4-oxo-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]butan-2-yl]carbamic acid (PubChem CID 67535872) has the molecular formula C34H44BF2N3O6 and a molecular weight of 639.55 g/mol. Its IUPAC name is [4-[3-[4,7-difluoro-1-(3-methoxypropyl)indol-2-yl]piperidin-1-yl]-4-oxo-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]butan-2-yl]carbamic acid.
| Compound Name | [4-[3-[4,7-difluoro-1-(3-methoxypropyl)indol-2-yl]piperidin-1-yl]-4-oxo-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]butan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 67535872 |
| Molecular Formula | C34H44BF2N3O6 |
| Molecular Weight | 639.55 g/mol |
| Exact Mass | 639.33 |
| IUPAC Name | [4-[3-[4,7-difluoro-1-(3-methoxypropyl)indol-2-yl]piperidin-1-yl]-4-oxo-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]butan-2-yl]carbamic acid |
| SMILES | COCCCn1c(C2CCCN(C(=O)CC(Cc3ccc(B4OC(C)(C)C(C)(C)O4)cc3)NC(=O)O)C2)cc2c(F)ccc(F)c21 |
| InChI | InChI=1S/C34H44BF2N3O6/c1-33(2)34(3,4)46-35(45-33)24-11-9-22(10-12-24)18-25(38-32(42)43)19-30(41)39-15-6-8-23(21-39)29-20-26-27(36)13-14-28(37)31(26)40(29)16-7-17-44-5/h9-14,20,23,25,38H,6-8,15-19,21H2,1-5H3,(H,42,43) |
| InChIKey | PVGLCIOKODNPJT-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 102.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.55 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|