C16H22N4S — CID 675366
10-methyl-12-(4-methyl-1,4-diazepan-1-yl)-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraene (PubChem CID 675366) has the molecular formula C16H22N4S and a molecular weight of 302.45 g/mol. Its IUPAC name is 10-methyl-12-(4-methyl-1,4-diazepan-1-yl)-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraene.
| Compound Name | 10-methyl-12-(4-methyl-1,4-diazepan-1-yl)-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraene |
|---|---|
| PubChem CID | 675366 |
| Molecular Formula | C16H22N4S |
| Molecular Weight | 302.45 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | 10-methyl-12-(4-methyl-1,4-diazepan-1-yl)-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraene |
| SMILES | Cc1nc(N2CCCN(C)CC2)c2c3c(sc2n1)CCC3 |
| InChI | InChI=1S/C16H22N4S/c1-11-17-15(20-8-4-7-19(2)9-10-20)14-12-5-3-6-13(12)21-16(14)18-11/h3-10H2,1-2H3 |
| InChIKey | FZHZDQJGFFXYRH-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.45 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |