C35H33F2N3O5 — CID 67536889
3-[1,1-difluoro-2-[4-[2-[[(2S)-2-hydroxy-2-(2-oxo-8-phenylmethoxy-1H-quinolin-5-yl)ethyl]amino]ethyl]phenoxy]ethyl]benzamide (PubChem CID 67536889) has the molecular formula C35H33F2N3O5 and a molecular weight of 613.66 g/mol. Its IUPAC name is 3-[1,1-difluoro-2-[4-[2-[[(2S)-2-hydroxy-2-(2-oxo-8-phenylmethoxy-1H-quinolin-5-yl)ethyl]amino]ethyl]phenoxy]ethyl]benzamide.
| Compound Name | 3-[1,1-difluoro-2-[4-[2-[[(2S)-2-hydroxy-2-(2-oxo-8-phenylmethoxy-1H-quinolin-5-yl)ethyl]amino]ethyl]phenoxy]ethyl]benzamide |
|---|---|
| PubChem CID | 67536889 |
| Molecular Formula | C35H33F2N3O5 |
| Molecular Weight | 613.66 g/mol |
| Exact Mass | 613.24 |
| IUPAC Name | 3-[1,1-difluoro-2-[4-[2-[[(2S)-2-hydroxy-2-(2-oxo-8-phenylmethoxy-1H-quinolin-5-yl)ethyl]amino]ethyl]phenoxy]ethyl]benzamide |
| SMILES | NC(=O)c1cccc(C(F)(F)COc2ccc(CCNC[C@@H](O)c3ccc(OCc4ccccc4)c4[nH]c(=O)ccc34)cc2)c1 |
| InChI | InChI=1S/C35H33F2N3O5/c36-35(37,26-8-4-7-25(19-26)34(38)43)22-45-27-11-9-23(10-12-27)17-18-39-20-30(41)28-13-15-31(33-29(28)14-16-32(42)40-33)44-21-24-5-2-1-3-6-24/h1-16,19,30,39,41H,17-18,20-22H2,(H2,38,43)(H,40,42)/t30-/m1/s1 |
| InChIKey | QMACPHHOLCIAHI-SSEXGKCCSA-N |
| XLogP | 5.24 |
| TPSA | 126.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.66 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|