C18H22N2O3 — CID 67536912
2,3,3a,4-tetrahydro-1H-pyrrolo[2,1-c][1,4]benzoxazin-7-amine;2-methylbenzene-1,3-diol (PubChem CID 67536912) has the molecular formula C18H22N2O3 and a molecular weight of 314.39 g/mol. Its IUPAC name is 2,3,3a,4-tetrahydro-1H-pyrrolo[2,1-c][1,4]benzoxazin-7-amine;2-methylbenzene-1,3-diol.
| Compound Name | 2,3,3a,4-tetrahydro-1H-pyrrolo[2,1-c][1,4]benzoxazin-7-amine;2-methylbenzene-1,3-diol |
|---|---|
| PubChem CID | 67536912 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | 2,3,3a,4-tetrahydro-1H-pyrrolo[2,1-c][1,4]benzoxazin-7-amine;2-methylbenzene-1,3-diol |
| SMILES | Cc1c(O)cccc1O.Nc1ccc2c(c1)OCC1CCCN21 |
| InChI | InChI=1S/C11H14N2O.C7H8O2/c12-8-3-4-10-11(6-8)14-7-9-2-1-5-13(9)10;1-5-6(8)3-2-4-7(5)9/h3-4,6,9H,1-2,5,7,12H2;2-4,8-9H,1H3 |
| InChIKey | GWCGKHACDPHZSN-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|