C23H36O5 — CID 67537232
(8R,9R,10R,13S,14S)-17,17-bis(1,2-dihydroxyethyl)-10,13-dimethyl-2,3,4,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-7-one (PubChem CID 67537232) has the molecular formula C23H36O5 and a molecular weight of 392.54 g/mol. Its IUPAC name is (8R,9R,10R,13S,14S)-17,17-bis(1,2-dihydroxyethyl)-10,13-dimethyl-2,3,4,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-7-one.
| Compound Name | (8R,9R,10R,13S,14S)-17,17-bis(1,2-dihydroxyethyl)-10,13-dimethyl-2,3,4,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-7-one |
|---|---|
| PubChem CID | 67537232 |
| Molecular Formula | C23H36O5 |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.26 |
| IUPAC Name | (8R,9R,10R,13S,14S)-17,17-bis(1,2-dihydroxyethyl)-10,13-dimethyl-2,3,4,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-7-one |
| SMILES | C[C@]12CCCCC1=CC(=O)[C@@H]1[C@H]2CC[C@@]2(C)[C@H]1CCC2(C(O)CO)C(O)CO |
| InChI | InChI=1S/C23H36O5/c1-21-8-4-3-5-14(21)11-17(26)20-15(21)6-9-22(2)16(20)7-10-23(22,18(27)12-24)19(28)13-25/h11,15-16,18-20,24-25,27-28H,3-10,12-13H2,1-2H3/t15-,16+,18?,19?,20-,21+,22+,23?/m1/s1 |
| InChIKey | UFTQYVYFRSFMOV-BNZJPNPXSA-N |
| XLogP | 2.21 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |