About azepan-1-yl acetate
azepan-1-yl acetate (PubChem CID 67537261) has the molecular formula C8H15NO2
and a molecular weight of 157.21 g/mol. Its IUPAC name is azepan-1-yl acetate.
Molecular Properties
| Compound Name | azepan-1-yl acetate |
| PubChem CID | 67537261 |
| Molecular Formula | C8H15NO2 |
| Molecular Weight | 157.21 g/mol |
| Exact Mass | 157.11 |
| IUPAC Name | azepan-1-yl acetate |
| SMILES | CC(=O)ON1CCCCCC1 |
| InChI | InChI=1S/C8H15NO2/c1-8(10)11-9-6-4-2-3-5-7-9/h2-7H2,1H3 |
| InChIKey | OSNCUJVZQJYZEJ-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.21 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze azepan-1-yl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azepan-1-yl acetate?
The IUPAC name of azepan-1-yl acetate (CID 67537261) is azepan-1-yl acetate.
What is the SMILES notation for azepan-1-yl acetate?
The canonical SMILES for azepan-1-yl acetate is CC(=O)ON1CCCCCC1.
What is the InChIKey of azepan-1-yl acetate?
The InChIKey is OSNCUJVZQJYZEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO2/c1-8(10)11-9-6-4-2-3-5-7-9/h2-7H2,1H3.
What are the key properties of azepan-1-yl acetate?
azepan-1-yl acetate has a molecular weight of 157.21 g/mol, XLogP of 1.34, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azepan-1-yl acetate is sourced from PubChem (CID 67537261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).