C30H39N5O3 — CID 67537347
7-methoxy-N-methyl-2-oxo-1-[2-[4-[(4-pyrrolidin-1-ylphenyl)methylamino]piperidin-1-yl]ethyl]quinoline-4-carboxamide (PubChem CID 67537347) has the molecular formula C30H39N5O3 and a molecular weight of 517.67 g/mol. Its IUPAC name is 7-methoxy-N-methyl-2-oxo-1-[2-[4-[(4-pyrrolidin-1-ylphenyl)methylamino]piperidin-1-yl]ethyl]quinoline-4-carboxamide.
| Compound Name | 7-methoxy-N-methyl-2-oxo-1-[2-[4-[(4-pyrrolidin-1-ylphenyl)methylamino]piperidin-1-yl]ethyl]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 67537347 |
| Molecular Formula | C30H39N5O3 |
| Molecular Weight | 517.67 g/mol |
| Exact Mass | 517.31 |
| IUPAC Name | 7-methoxy-N-methyl-2-oxo-1-[2-[4-[(4-pyrrolidin-1-ylphenyl)methylamino]piperidin-1-yl]ethyl]quinoline-4-carboxamide |
| SMILES | CNC(=O)c1cc(=O)n(CCN2CCC(NCc3ccc(N4CCCC4)cc3)CC2)c2cc(OC)ccc12 |
| InChI | InChI=1S/C30H39N5O3/c1-31-30(37)27-20-29(36)35(28-19-25(38-2)9-10-26(27)28)18-17-33-15-11-23(12-16-33)32-21-22-5-7-24(8-6-22)34-13-3-4-14-34/h5-10,19-20,23,32H,3-4,11-18,21H2,1-2H3,(H,31,37) |
| InChIKey | UOQBZWNNVKLUGQ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.67 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|