About 1-[4-[(1R)-3,3-difluorocyclohexyl]butyl]-2-methylimidazole
1-[4-[(1R)-3,3-difluorocyclohexyl]butyl]-2-methylimidazole (PubChem CID 67537599) has the molecular formula C14H22F2N2
and a molecular weight of 256.34 g/mol. Its IUPAC name is 1-[4-[(1R)-3,3-difluorocyclohexyl]butyl]-2-methylimidazole.
Molecular Properties
| Compound Name | 1-[4-[(1R)-3,3-difluorocyclohexyl]butyl]-2-methylimidazole |
| PubChem CID | 67537599 |
| Molecular Formula | C14H22F2N2 |
| Molecular Weight | 256.34 g/mol |
| Exact Mass | 256.18 |
| IUPAC Name | 1-[4-[(1R)-3,3-difluorocyclohexyl]butyl]-2-methylimidazole |
| SMILES | Cc1nccn1CCCC[C@@H]1CCCC(F)(F)C1 |
| InChI | InChI=1S/C14H22F2N2/c1-12-17-8-10-18(12)9-3-2-5-13-6-4-7-14(15,16)11-13/h8,10,13H,2-7,9,11H2,1H3/t13-/m1/s1 |
| InChIKey | HUQSBCHXUFYNDZ-CYBMUJFWSA-N |
| XLogP | 4.19 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.34 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-[(1R)-3,3-difluorocyclohexyl]butyl]-2-methylimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-[(1R)-3,3-difluorocyclohexyl]butyl]-2-methylimidazole?
The IUPAC name of 1-[4-[(1R)-3,3-difluorocyclohexyl]butyl]-2-methylimidazole (CID 67537599) is 1-[4-[(1R)-3,3-difluorocyclohexyl]butyl]-2-methylimidazole.
What is the SMILES notation for 1-[4-[(1R)-3,3-difluorocyclohexyl]butyl]-2-methylimidazole?
The canonical SMILES for 1-[4-[(1R)-3,3-difluorocyclohexyl]butyl]-2-methylimidazole is Cc1nccn1CCCC[C@@H]1CCCC(F)(F)C1.
What is the InChIKey of 1-[4-[(1R)-3,3-difluorocyclohexyl]butyl]-2-methylimidazole?
The InChIKey is HUQSBCHXUFYNDZ-CYBMUJFWSA-N. The full InChI is InChI=1S/C14H22F2N2/c1-12-17-8-10-18(12)9-3-2-5-13-6-4-7-14(15,16)11-13/h8,10,13H,2-7,9,11H2,1H3/t13-/m1/s1.
What are the key properties of 1-[4-[(1R)-3,3-difluorocyclohexyl]butyl]-2-methylimidazole?
1-[4-[(1R)-3,3-difluorocyclohexyl]butyl]-2-methylimidazole has a molecular weight of 256.34 g/mol, XLogP of 4.19, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-[(1R)-3,3-difluorocyclohexyl]butyl]-2-methylimidazole is sourced from PubChem (CID 67537599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).