C17H15IN4O3 — CID 67538015
2-iodo-5-[(6-methyl-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-4-yl)oxy]indole-1-carboxylic acid (PubChem CID 67538015) has the molecular formula C17H15IN4O3 and a molecular weight of 450.24 g/mol. Its IUPAC name is 2-iodo-5-[(6-methyl-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-4-yl)oxy]indole-1-carboxylic acid.
| Compound Name | 2-iodo-5-[(6-methyl-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-4-yl)oxy]indole-1-carboxylic acid |
|---|---|
| PubChem CID | 67538015 |
| Molecular Formula | C17H15IN4O3 |
| Molecular Weight | 450.24 g/mol |
| Exact Mass | 450.02 |
| IUPAC Name | 2-iodo-5-[(6-methyl-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-4-yl)oxy]indole-1-carboxylic acid |
| SMILES | CC1Cc2c(ncnc2Oc2ccc3c(c2)cc(I)n3C(=O)O)CN1 |
| InChI | InChI=1S/C17H15IN4O3/c1-9-4-12-13(7-19-9)20-8-21-16(12)25-11-2-3-14-10(5-11)6-15(18)22(14)17(23)24/h2-3,5-6,8-9,19H,4,7H2,1H3,(H,23,24) |
| InChIKey | HJLGUZQTVHRKHY-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.24 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|