About 7-bromo-1-cyclohexyl-3,4-dihydroisoquinoline
7-bromo-1-cyclohexyl-3,4-dihydroisoquinoline (PubChem CID 67538221) has the molecular formula C15H18BrN
and a molecular weight of 292.22 g/mol. Its IUPAC name is 7-bromo-1-cyclohexyl-3,4-dihydroisoquinoline.
Molecular Properties
| Compound Name | 7-bromo-1-cyclohexyl-3,4-dihydroisoquinoline |
| PubChem CID | 67538221 |
| Molecular Formula | C15H18BrN |
| Molecular Weight | 292.22 g/mol |
| Exact Mass | 291.06 |
| IUPAC Name | 7-bromo-1-cyclohexyl-3,4-dihydroisoquinoline |
| SMILES | Brc1ccc2c(c1)C(C1CCCCC1)=NCC2 |
| InChI | InChI=1S/C15H18BrN/c16-13-7-6-11-8-9-17-15(14(11)10-13)12-4-2-1-3-5-12/h6-7,10,12H,1-5,8-9H2 |
| InChIKey | YNGDJYLOZLMVJT-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.22 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 7-bromo-1-cyclohexyl-3,4-dihydroisoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-1-cyclohexyl-3,4-dihydroisoquinoline?
The IUPAC name of 7-bromo-1-cyclohexyl-3,4-dihydroisoquinoline (CID 67538221) is 7-bromo-1-cyclohexyl-3,4-dihydroisoquinoline.
What is the SMILES notation for 7-bromo-1-cyclohexyl-3,4-dihydroisoquinoline?
The canonical SMILES for 7-bromo-1-cyclohexyl-3,4-dihydroisoquinoline is Brc1ccc2c(c1)C(C1CCCCC1)=NCC2.
What is the InChIKey of 7-bromo-1-cyclohexyl-3,4-dihydroisoquinoline?
The InChIKey is YNGDJYLOZLMVJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18BrN/c16-13-7-6-11-8-9-17-15(14(11)10-13)12-4-2-1-3-5-12/h6-7,10,12H,1-5,8-9H2.
What are the key properties of 7-bromo-1-cyclohexyl-3,4-dihydroisoquinoline?
7-bromo-1-cyclohexyl-3,4-dihydroisoquinoline has a molecular weight of 292.22 g/mol, XLogP of 4.37, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-1-cyclohexyl-3,4-dihydroisoquinoline is sourced from PubChem (CID 67538221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).