C24H31NO3Si — CID 67538361
(1S,4S,6S)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-azabicyclo[4.1.0]heptane-3-carboxylic acid (PubChem CID 67538361) has the molecular formula C24H31NO3Si and a molecular weight of 409.60 g/mol. Its IUPAC name is (1S,4S,6S)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-azabicyclo[4.1.0]heptane-3-carboxylic acid.
| Compound Name | (1S,4S,6S)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-azabicyclo[4.1.0]heptane-3-carboxylic acid |
|---|---|
| PubChem CID | 67538361 |
| Molecular Formula | C24H31NO3Si |
| Molecular Weight | 409.60 g/mol |
| Exact Mass | 409.21 |
| IUPAC Name | (1S,4S,6S)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-azabicyclo[4.1.0]heptane-3-carboxylic acid |
| SMILES | CC(C)(C)[Si](OC[C@@H]1C[C@@H]2C[C@@H]2CN1C(=O)O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H31NO3Si/c1-24(2,3)29(21-10-6-4-7-11-21,22-12-8-5-9-13-22)28-17-20-15-18-14-19(18)16-25(20)23(26)27/h4-13,18-20H,14-17H2,1-3H3,(H,26,27)/t18-,19+,20-/m0/s1 |
| InChIKey | WZMARCQNGQKEJA-ZCNNSNEGSA-N |
| XLogP | 3.95 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.60 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|