About 4-piperazin-1-yl-5,7-dihydropyrrolo[2,3-d]pyrimidin-6-one;dihydrochloride
4-piperazin-1-yl-5,7-dihydropyrrolo[2,3-d]pyrimidin-6-one;dihydrochloride (PubChem CID 67538771) has the molecular formula C10H15Cl2N5O
and a molecular weight of 292.17 g/mol. Its IUPAC name is 4-piperazin-1-yl-5,7-dihydropyrrolo[2,3-d]pyrimidin-6-one;dihydrochloride.
Molecular Properties
| Compound Name | 4-piperazin-1-yl-5,7-dihydropyrrolo[2,3-d]pyrimidin-6-one;dihydrochloride |
| PubChem CID | 67538771 |
| Molecular Formula | C10H15Cl2N5O |
| Molecular Weight | 292.17 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | 4-piperazin-1-yl-5,7-dihydropyrrolo[2,3-d]pyrimidin-6-one;dihydrochloride |
| SMILES | Cl.Cl.O=C1Cc2c(ncnc2N2CCNCC2)N1 |
| InChI | InChI=1S/C10H13N5O.2ClH/c16-8-5-7-9(14-8)12-6-13-10(7)15-3-1-11-2-4-15;;/h6,11H,1-5H2,(H,12,13,14,16);2*1H |
| InChIKey | RHGWNSSGRCBEDD-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.17 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-piperazin-1-yl-5,7-dihydropyrrolo[2,3-d]pyrimidin-6-one;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-piperazin-1-yl-5,7-dihydropyrrolo[2,3-d]pyrimidin-6-one;dihydrochloride?
The IUPAC name of 4-piperazin-1-yl-5,7-dihydropyrrolo[2,3-d]pyrimidin-6-one;dihydrochloride (CID 67538771) is 4-piperazin-1-yl-5,7-dihydropyrrolo[2,3-d]pyrimidin-6-one;dihydrochloride.
What is the SMILES notation for 4-piperazin-1-yl-5,7-dihydropyrrolo[2,3-d]pyrimidin-6-one;dihydrochloride?
The canonical SMILES for 4-piperazin-1-yl-5,7-dihydropyrrolo[2,3-d]pyrimidin-6-one;dihydrochloride is Cl.Cl.O=C1Cc2c(ncnc2N2CCNCC2)N1.
What is the InChIKey of 4-piperazin-1-yl-5,7-dihydropyrrolo[2,3-d]pyrimidin-6-one;dihydrochloride?
The InChIKey is RHGWNSSGRCBEDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N5O.2ClH/c16-8-5-7-9(14-8)12-6-13-10(7)15-3-1-11-2-4-15;;/h6,11H,1-5H2,(H,12,13,14,16);2*1H.
What are the key properties of 4-piperazin-1-yl-5,7-dihydropyrrolo[2,3-d]pyrimidin-6-one;dihydrochloride?
4-piperazin-1-yl-5,7-dihydropyrrolo[2,3-d]pyrimidin-6-one;dihydrochloride has a molecular weight of 292.17 g/mol, XLogP of 0.22, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-piperazin-1-yl-5,7-dihydropyrrolo[2,3-d]pyrimidin-6-one;dihydrochloride is sourced from PubChem (CID 67538771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).