About 2-[[1-(1,3-dioxolan-2-ylmethyl)-7-methoxy-2-oxoquinolin-4-yl]methylidene]butanoic acid
2-[[1-(1,3-dioxolan-2-ylmethyl)-7-methoxy-2-oxoquinolin-4-yl]methylidene]butanoic acid (PubChem CID 67539134) has the molecular formula C19H21NO6
and a molecular weight of 359.38 g/mol. Its IUPAC name is 2-[[1-(1,3-dioxolan-2-ylmethyl)-7-methoxy-2-oxoquinolin-4-yl]methylidene]butanoic acid.
Molecular Properties
| Compound Name | 2-[[1-(1,3-dioxolan-2-ylmethyl)-7-methoxy-2-oxoquinolin-4-yl]methylidene]butanoic acid |
| PubChem CID | 67539134 |
| Molecular Formula | C19H21NO6 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | 2-[[1-(1,3-dioxolan-2-ylmethyl)-7-methoxy-2-oxoquinolin-4-yl]methylidene]butanoic acid |
| SMILES | CCC(=Cc1cc(=O)n(CC2OCCO2)c2cc(OC)ccc12)C(=O)O |
| InChI | InChI=1S/C19H21NO6/c1-3-12(19(22)23)8-13-9-17(21)20(11-18-25-6-7-26-18)16-10-14(24-2)4-5-15(13)16/h4-5,8-10,18H,3,6-7,11H2,1-2H3,(H,22,23) |
| InChIKey | VQNHTMWBVWXGIT-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[[1-(1,3-dioxolan-2-ylmethyl)-7-methoxy-2-oxoquinolin-4-yl]methylidene]butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[1-(1,3-dioxolan-2-ylmethyl)-7-methoxy-2-oxoquinolin-4-yl]methylidene]butanoic acid?
The IUPAC name of 2-[[1-(1,3-dioxolan-2-ylmethyl)-7-methoxy-2-oxoquinolin-4-yl]methylidene]butanoic acid (CID 67539134) is 2-[[1-(1,3-dioxolan-2-ylmethyl)-7-methoxy-2-oxoquinolin-4-yl]methylidene]butanoic acid.
What is the SMILES notation for 2-[[1-(1,3-dioxolan-2-ylmethyl)-7-methoxy-2-oxoquinolin-4-yl]methylidene]butanoic acid?
The canonical SMILES for 2-[[1-(1,3-dioxolan-2-ylmethyl)-7-methoxy-2-oxoquinolin-4-yl]methylidene]butanoic acid is CCC(=Cc1cc(=O)n(CC2OCCO2)c2cc(OC)ccc12)C(=O)O.
What is the InChIKey of 2-[[1-(1,3-dioxolan-2-ylmethyl)-7-methoxy-2-oxoquinolin-4-yl]methylidene]butanoic acid?
The InChIKey is VQNHTMWBVWXGIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21NO6/c1-3-12(19(22)23)8-13-9-17(21)20(11-18-25-6-7-26-18)16-10-14(24-2)4-5-15(13)16/h4-5,8-10,18H,3,6-7,11H2,1-2H3,(H,22,23).
What are the key properties of 2-[[1-(1,3-dioxolan-2-ylmethyl)-7-methoxy-2-oxoquinolin-4-yl]methylidene]butanoic acid?
2-[[1-(1,3-dioxolan-2-ylmethyl)-7-methoxy-2-oxoquinolin-4-yl]methylidene]butanoic acid has a molecular weight of 359.38 g/mol, XLogP of 2.26, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[1-(1,3-dioxolan-2-ylmethyl)-7-methoxy-2-oxoquinolin-4-yl]methylidene]butanoic acid is sourced from PubChem (CID 67539134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).