About 3-cyclopropyl-4-piperazin-1-yl-2H-pyrazolo[3,4-d]pyrimidine;dihydrochloride
3-cyclopropyl-4-piperazin-1-yl-2H-pyrazolo[3,4-d]pyrimidine;dihydrochloride (PubChem CID 67539522) has the molecular formula C12H18Cl2N6
and a molecular weight of 317.22 g/mol. Its IUPAC name is 3-cyclopropyl-4-piperazin-1-yl-2H-pyrazolo[3,4-d]pyrimidine;dihydrochloride.
Molecular Properties
| Compound Name | 3-cyclopropyl-4-piperazin-1-yl-2H-pyrazolo[3,4-d]pyrimidine;dihydrochloride |
| PubChem CID | 67539522 |
| Molecular Formula | C12H18Cl2N6 |
| Molecular Weight | 317.22 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | 3-cyclopropyl-4-piperazin-1-yl-2H-pyrazolo[3,4-d]pyrimidine;dihydrochloride |
| SMILES | Cl.Cl.c1nc(N2CCNCC2)c2c(C3CC3)[nH]nc2n1 |
| InChI | InChI=1S/C12H16N6.2ClH/c1-2-8(1)10-9-11(17-16-10)14-7-15-12(9)18-5-3-13-4-6-18;;/h7-8,13H,1-6H2,(H,14,15,16,17);2*1H |
| InChIKey | BSUCOXKDOBOYTD-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 69.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.22 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-cyclopropyl-4-piperazin-1-yl-2H-pyrazolo[3,4-d]pyrimidine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclopropyl-4-piperazin-1-yl-2H-pyrazolo[3,4-d]pyrimidine;dihydrochloride?
The IUPAC name of 3-cyclopropyl-4-piperazin-1-yl-2H-pyrazolo[3,4-d]pyrimidine;dihydrochloride (CID 67539522) is 3-cyclopropyl-4-piperazin-1-yl-2H-pyrazolo[3,4-d]pyrimidine;dihydrochloride.
What is the SMILES notation for 3-cyclopropyl-4-piperazin-1-yl-2H-pyrazolo[3,4-d]pyrimidine;dihydrochloride?
The canonical SMILES for 3-cyclopropyl-4-piperazin-1-yl-2H-pyrazolo[3,4-d]pyrimidine;dihydrochloride is Cl.Cl.c1nc(N2CCNCC2)c2c(C3CC3)[nH]nc2n1.
What is the InChIKey of 3-cyclopropyl-4-piperazin-1-yl-2H-pyrazolo[3,4-d]pyrimidine;dihydrochloride?
The InChIKey is BSUCOXKDOBOYTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N6.2ClH/c1-2-8(1)10-9-11(17-16-10)14-7-15-12(9)18-5-3-13-4-6-18;;/h7-8,13H,1-6H2,(H,14,15,16,17);2*1H.
What are the key properties of 3-cyclopropyl-4-piperazin-1-yl-2H-pyrazolo[3,4-d]pyrimidine;dihydrochloride?
3-cyclopropyl-4-piperazin-1-yl-2H-pyrazolo[3,4-d]pyrimidine;dihydrochloride has a molecular weight of 317.22 g/mol, XLogP of 1.48, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclopropyl-4-piperazin-1-yl-2H-pyrazolo[3,4-d]pyrimidine;dihydrochloride is sourced from PubChem (CID 67539522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).