About 4-piperazin-1-yl-1H-pyrazolo[5,4-d]pyrimidine;dihydrochloride
4-piperazin-1-yl-1H-pyrazolo[5,4-d]pyrimidine;dihydrochloride (PubChem CID 67539839) has the molecular formula C9H14Cl2N6
and a molecular weight of 277.16 g/mol. Its IUPAC name is 4-piperazin-1-yl-1H-pyrazolo[5,4-d]pyrimidine;dihydrochloride.
Molecular Properties
| Compound Name | 4-piperazin-1-yl-1H-pyrazolo[5,4-d]pyrimidine;dihydrochloride |
| PubChem CID | 67539839 |
| Molecular Formula | C9H14Cl2N6 |
| Molecular Weight | 277.16 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | 4-piperazin-1-yl-1H-pyrazolo[5,4-d]pyrimidine;dihydrochloride |
| SMILES | Cl.Cl.c1nc(N2CCNCC2)c2cn[nH]c2n1 |
| InChI | InChI=1S/C9H12N6.2ClH/c1-3-15(4-2-10-1)9-7-5-13-14-8(7)11-6-12-9;;/h5-6,10H,1-4H2,(H,11,12,13,14);2*1H |
| InChIKey | BGWCQWVNLUSNFF-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 69.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.16 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-piperazin-1-yl-1H-pyrazolo[5,4-d]pyrimidine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-piperazin-1-yl-1H-pyrazolo[5,4-d]pyrimidine;dihydrochloride?
The IUPAC name of 4-piperazin-1-yl-1H-pyrazolo[5,4-d]pyrimidine;dihydrochloride (CID 67539839) is 4-piperazin-1-yl-1H-pyrazolo[5,4-d]pyrimidine;dihydrochloride.
What is the SMILES notation for 4-piperazin-1-yl-1H-pyrazolo[5,4-d]pyrimidine;dihydrochloride?
The canonical SMILES for 4-piperazin-1-yl-1H-pyrazolo[5,4-d]pyrimidine;dihydrochloride is Cl.Cl.c1nc(N2CCNCC2)c2cn[nH]c2n1.
What is the InChIKey of 4-piperazin-1-yl-1H-pyrazolo[5,4-d]pyrimidine;dihydrochloride?
The InChIKey is BGWCQWVNLUSNFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N6.2ClH/c1-3-15(4-2-10-1)9-7-5-13-14-8(7)11-6-12-9;;/h5-6,10H,1-4H2,(H,11,12,13,14);2*1H.
What are the key properties of 4-piperazin-1-yl-1H-pyrazolo[5,4-d]pyrimidine;dihydrochloride?
4-piperazin-1-yl-1H-pyrazolo[5,4-d]pyrimidine;dihydrochloride has a molecular weight of 277.16 g/mol, XLogP of 0.61, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-piperazin-1-yl-1H-pyrazolo[5,4-d]pyrimidine;dihydrochloride is sourced from PubChem (CID 67539839), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).