C51H61B2NO4 — CID 67539927
9-[3-[3,5-bis[3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propyl]phenyl]propyl]carbazole (PubChem CID 67539927) has the molecular formula C51H61B2NO4 and a molecular weight of 773.68 g/mol. Its IUPAC name is 9-[3-[3,5-bis[3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propyl]phenyl]propyl]carbazole.
| Compound Name | 9-[3-[3,5-bis[3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propyl]phenyl]propyl]carbazole |
|---|---|
| PubChem CID | 67539927 |
| Molecular Formula | C51H61B2NO4 |
| Molecular Weight | 773.68 g/mol |
| Exact Mass | 773.48 |
| IUPAC Name | 9-[3-[3,5-bis[3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propyl]phenyl]propyl]carbazole |
| SMILES | CC1(C)OB(c2ccc(CCCc3cc(CCCc4ccc(B5OC(C)(C)C(C)(C)O5)cc4)cc(CCCn4c5ccccc5c5ccccc54)c3)cc2)OC1(C)C |
| InChI | InChI=1S/C51H61B2NO4/c1-48(2)49(3,4)56-52(55-48)42-29-25-37(26-30-42)16-13-18-39-34-40(19-14-17-38-27-31-43(32-28-38)53-57-50(5,6)51(7,8)58-53)36-41(35-39)20-15-33-54-46-23-11-9-21-44(46)45-22-10-12-24-47(45)54/h9-12,21-32,34-36H,13-20,33H2,1-8H3 |
| InChIKey | FGSJLXJXTMXSQH-UHFFFAOYSA-N |
| XLogP | 10.38 |
| TPSA | 41.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 773.68 |
| LogP ≤ 5 | 10.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|