C33H32N6O4S — CID 67539991
N-[2-[7-(benzylamino)-6-(4-phenylpiperidine-1-carbonyl)pyrazolo[1,5-a]pyrimidine-3-carbonyl]phenyl]methanesulfonamide (PubChem CID 67539991) has the molecular formula C33H32N6O4S and a molecular weight of 608.72 g/mol. Its IUPAC name is N-[2-[7-(benzylamino)-6-(4-phenylpiperidine-1-carbonyl)pyrazolo[1,5-a]pyrimidine-3-carbonyl]phenyl]methanesulfonamide.
| Compound Name | N-[2-[7-(benzylamino)-6-(4-phenylpiperidine-1-carbonyl)pyrazolo[1,5-a]pyrimidine-3-carbonyl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 67539991 |
| Molecular Formula | C33H32N6O4S |
| Molecular Weight | 608.72 g/mol |
| Exact Mass | 608.22 |
| IUPAC Name | N-[2-[7-(benzylamino)-6-(4-phenylpiperidine-1-carbonyl)pyrazolo[1,5-a]pyrimidine-3-carbonyl]phenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1ccccc1C(=O)c1cnn2c(NCc3ccccc3)c(C(=O)N3CCC(c4ccccc4)CC3)cnc12 |
| InChI | InChI=1S/C33H32N6O4S/c1-44(42,43)37-29-15-9-8-14-26(29)30(40)27-22-36-39-31(27)35-21-28(32(39)34-20-23-10-4-2-5-11-23)33(41)38-18-16-25(17-19-38)24-12-6-3-7-13-24/h2-15,21-22,25,34,37H,16-20H2,1H3 |
| InChIKey | QAMSZDKAGHEOQM-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 125.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.72 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|