About 5-[8-[3,5-difluoro-4-(morpholin-4-ylmethyl)phenyl]quinoxalin-2-yl]pyridine-2-carboxylic acid
5-[8-[3,5-difluoro-4-(morpholin-4-ylmethyl)phenyl]quinoxalin-2-yl]pyridine-2-carboxylic acid (PubChem CID 67540815) has the molecular formula C25H20F2N4O3
and a molecular weight of 462.46 g/mol. Its IUPAC name is 5-[8-[3,5-difluoro-4-(morpholin-4-ylmethyl)phenyl]quinoxalin-2-yl]pyridine-2-carboxylic acid.
Molecular Properties
| Compound Name | 5-[8-[3,5-difluoro-4-(morpholin-4-ylmethyl)phenyl]quinoxalin-2-yl]pyridine-2-carboxylic acid |
| PubChem CID | 67540815 |
| Molecular Formula | C25H20F2N4O3 |
| Molecular Weight | 462.46 g/mol |
| Exact Mass | 462.15 |
| IUPAC Name | 5-[8-[3,5-difluoro-4-(morpholin-4-ylmethyl)phenyl]quinoxalin-2-yl]pyridine-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(-c2cnc3cccc(-c4cc(F)c(CN5CCOCC5)c(F)c4)c3n2)cn1 |
| InChI | InChI=1S/C25H20F2N4O3/c26-19-10-16(11-20(27)18(19)14-31-6-8-34-9-7-31)17-2-1-3-21-24(17)30-23(13-29-21)15-4-5-22(25(32)33)28-12-15/h1-5,10-13H,6-9,14H2,(H,32,33) |
| InChIKey | QXGRNYZJZCDLSX-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 88.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 462.46 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-[8-[3,5-difluoro-4-(morpholin-4-ylmethyl)phenyl]quinoxalin-2-yl]pyridine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[8-[3,5-difluoro-4-(morpholin-4-ylmethyl)phenyl]quinoxalin-2-yl]pyridine-2-carboxylic acid?
The IUPAC name of 5-[8-[3,5-difluoro-4-(morpholin-4-ylmethyl)phenyl]quinoxalin-2-yl]pyridine-2-carboxylic acid (CID 67540815) is 5-[8-[3,5-difluoro-4-(morpholin-4-ylmethyl)phenyl]quinoxalin-2-yl]pyridine-2-carboxylic acid.
What is the SMILES notation for 5-[8-[3,5-difluoro-4-(morpholin-4-ylmethyl)phenyl]quinoxalin-2-yl]pyridine-2-carboxylic acid?
The canonical SMILES for 5-[8-[3,5-difluoro-4-(morpholin-4-ylmethyl)phenyl]quinoxalin-2-yl]pyridine-2-carboxylic acid is O=C(O)c1ccc(-c2cnc3cccc(-c4cc(F)c(CN5CCOCC5)c(F)c4)c3n2)cn1.
What is the InChIKey of 5-[8-[3,5-difluoro-4-(morpholin-4-ylmethyl)phenyl]quinoxalin-2-yl]pyridine-2-carboxylic acid?
The InChIKey is QXGRNYZJZCDLSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H20F2N4O3/c26-19-10-16(11-20(27)18(19)14-31-6-8-34-9-7-31)17-2-1-3-21-24(17)30-23(13-29-21)15-4-5-22(25(32)33)28-12-15/h1-5,10-13H,6-9,14H2,(H,32,33).
What are the key properties of 5-[8-[3,5-difluoro-4-(morpholin-4-ylmethyl)phenyl]quinoxalin-2-yl]pyridine-2-carboxylic acid?
5-[8-[3,5-difluoro-4-(morpholin-4-ylmethyl)phenyl]quinoxalin-2-yl]pyridine-2-carboxylic acid has a molecular weight of 462.46 g/mol, XLogP of 4.17, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[8-[3,5-difluoro-4-(morpholin-4-ylmethyl)phenyl]quinoxalin-2-yl]pyridine-2-carboxylic acid is sourced from PubChem (CID 67540815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).