C7H16ClNO — CID 67541561
cis-(1S,2R)-2-methoxycyclohexan-1-amine;hydrochloride (PubChem CID 67541561) has the molecular formula C7H16ClNO and a molecular weight of 165.66 g/mol. Its IUPAC name is cis-(1S,2R)-2-methoxycyclohexan-1-amine;hydrochloride.
| Compound Name | cis-(1S,2R)-2-methoxycyclohexan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 67541561 |
| Molecular Formula | C7H16ClNO |
| Molecular Weight | 165.66 g/mol |
| Exact Mass | 165.09 |
| IUPAC Name | cis-(1S,2R)-2-methoxycyclohexan-1-amine;hydrochloride |
| SMILES | CO[C@@H]1CCCC[C@@H]1N.Cl |
| InChI | InChI=1S/C7H15NO.ClH/c1-9-7-5-3-2-4-6(7)8;/h6-7H,2-5,8H2,1H3;1H/t6-,7+;/m0./s1 |
| InChIKey | IFYWPFJJXZHMCZ-UOERWJHTSA-N |
| XLogP | 1.32 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.66 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |