C22H33N3O5S — CID 67542130
methyl 9-[2-[[(1S,2S)-1-amino-2-ethenylcyclopropanecarbonyl]sulfamoyl]anilino]nonanoate (PubChem CID 67542130) has the molecular formula C22H33N3O5S and a molecular weight of 451.59 g/mol. Its IUPAC name is methyl 9-[2-[[(1S,2S)-1-amino-2-ethenylcyclopropanecarbonyl]sulfamoyl]anilino]nonanoate.
| Compound Name | methyl 9-[2-[[(1S,2S)-1-amino-2-ethenylcyclopropanecarbonyl]sulfamoyl]anilino]nonanoate |
|---|---|
| PubChem CID | 67542130 |
| Molecular Formula | C22H33N3O5S |
| Molecular Weight | 451.59 g/mol |
| Exact Mass | 451.21 |
| IUPAC Name | methyl 9-[2-[[(1S,2S)-1-amino-2-ethenylcyclopropanecarbonyl]sulfamoyl]anilino]nonanoate |
| SMILES | C=C[C@@H]1C[C@@]1(N)C(=O)NS(=O)(=O)c1ccccc1NCCCCCCCCC(=O)OC |
| InChI | InChI=1S/C22H33N3O5S/c1-3-17-16-22(17,23)21(27)25-31(28,29)19-13-10-9-12-18(19)24-15-11-7-5-4-6-8-14-20(26)30-2/h3,9-10,12-13,17,24H,1,4-8,11,14-16,23H2,2H3,(H,25,27)/t17-,22+/m1/s1 |
| InChIKey | XJVLLQVOFSLFHW-VGSWGCGISA-N |
| XLogP | 2.71 |
| TPSA | 127.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.59 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|