About 3,5-diaminobenzoate;triethylazanium
3,5-diaminobenzoate;triethylazanium (PubChem CID 67542244) has the molecular formula C13H23N3O2
and a molecular weight of 253.35 g/mol. Its IUPAC name is 3,5-diaminobenzoate;triethylazanium.
Molecular Properties
| Compound Name | 3,5-diaminobenzoate;triethylazanium |
| PubChem CID | 67542244 |
| Molecular Formula | C13H23N3O2 |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.18 |
| IUPAC Name | 3,5-diaminobenzoate;triethylazanium |
| SMILES | CC[NH+](CC)CC.Nc1cc(N)cc(C(=O)[O-])c1 |
| InChI | InChI=1S/C7H8N2O2.C6H15N/c8-5-1-4(7(10)11)2-6(9)3-5;1-4-7(5-2)6-3/h1-3H,8-9H2,(H,10,11);4-6H2,1-3H3 |
| InChIKey | DRMOAQPJAADKCP-UHFFFAOYSA-N |
| XLogP | -0.85 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3,5-diaminobenzoate;triethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-diaminobenzoate;triethylazanium?
The IUPAC name of 3,5-diaminobenzoate;triethylazanium (CID 67542244) is 3,5-diaminobenzoate;triethylazanium.
What is the SMILES notation for 3,5-diaminobenzoate;triethylazanium?
The canonical SMILES for 3,5-diaminobenzoate;triethylazanium is CC[NH+](CC)CC.Nc1cc(N)cc(C(=O)[O-])c1.
What is the InChIKey of 3,5-diaminobenzoate;triethylazanium?
The InChIKey is DRMOAQPJAADKCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O2.C6H15N/c8-5-1-4(7(10)11)2-6(9)3-5;1-4-7(5-2)6-3/h1-3H,8-9H2,(H,10,11);4-6H2,1-3H3.
What are the key properties of 3,5-diaminobenzoate;triethylazanium?
3,5-diaminobenzoate;triethylazanium has a molecular weight of 253.35 g/mol, XLogP of -0.85, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-diaminobenzoate;triethylazanium is sourced from PubChem (CID 67542244), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).