C29H28F3N5O4 — CID 67542261
2-[[2-[3-[(4-methoxyphenyl)methyl]-8,9-dihydro-6H-pyrazolo[4,3-f][2,7]naphthyridin-7-yl]-2-oxo-1-phenylethyl]amino]ethyl 2,2,2-trifluoroacetate (PubChem CID 67542261) has the molecular formula C29H28F3N5O4 and a molecular weight of 567.57 g/mol. Its IUPAC name is 2-[[2-[3-[(4-methoxyphenyl)methyl]-8,9-dihydro-6H-pyrazolo[4,3-f][2,7]naphthyridin-7-yl]-2-oxo-1-phenylethyl]amino]ethyl 2,2,2-trifluoroacetate.
| Compound Name | 2-[[2-[3-[(4-methoxyphenyl)methyl]-8,9-dihydro-6H-pyrazolo[4,3-f][2,7]naphthyridin-7-yl]-2-oxo-1-phenylethyl]amino]ethyl 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 67542261 |
| Molecular Formula | C29H28F3N5O4 |
| Molecular Weight | 567.57 g/mol |
| Exact Mass | 567.21 |
| IUPAC Name | 2-[[2-[3-[(4-methoxyphenyl)methyl]-8,9-dihydro-6H-pyrazolo[4,3-f][2,7]naphthyridin-7-yl]-2-oxo-1-phenylethyl]amino]ethyl 2,2,2-trifluoroacetate |
| SMILES | COc1ccc(Cn2ncc3c4c(cnc32)CN(C(=O)C(NCCOC(=O)C(F)(F)F)c2ccccc2)CC4)cc1 |
| InChI | InChI=1S/C29H28F3N5O4/c1-40-22-9-7-19(8-10-22)17-37-26-24(16-35-37)23-11-13-36(18-21(23)15-34-26)27(38)25(20-5-3-2-4-6-20)33-12-14-41-28(39)29(30,31)32/h2-10,15-16,25,33H,11-14,17-18H2,1H3 |
| InChIKey | ZXKYOHOMMIHYAG-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 98.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.57 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|