C28H34N2O — CID 67542707
(6S,10bR)-6-(4-methoxyphenyl)-9-(4-piperidin-1-ylbut-1-ynyl)-1,2,3,5,6,10b-hexahydropyrrolo[2,1-a]isoquinoline (PubChem CID 67542707) has the molecular formula C28H34N2O and a molecular weight of 414.59 g/mol. Its IUPAC name is (6S,10bR)-6-(4-methoxyphenyl)-9-(4-piperidin-1-ylbut-1-ynyl)-1,2,3,5,6,10b-hexahydropyrrolo[2,1-a]isoquinoline.
| Compound Name | (6S,10bR)-6-(4-methoxyphenyl)-9-(4-piperidin-1-ylbut-1-ynyl)-1,2,3,5,6,10b-hexahydropyrrolo[2,1-a]isoquinoline |
|---|---|
| PubChem CID | 67542707 |
| Molecular Formula | C28H34N2O |
| Molecular Weight | 414.59 g/mol |
| Exact Mass | 414.27 |
| IUPAC Name | (6S,10bR)-6-(4-methoxyphenyl)-9-(4-piperidin-1-ylbut-1-ynyl)-1,2,3,5,6,10b-hexahydropyrrolo[2,1-a]isoquinoline |
| SMILES | COc1ccc([C@@H]2CN3CCC[C@@H]3c3cc(C#CCCN4CCCCC4)ccc32)cc1 |
| InChI | InChI=1S/C28H34N2O/c1-31-24-13-11-23(12-14-24)27-21-30-19-7-9-28(30)26-20-22(10-15-25(26)27)8-3-6-18-29-16-4-2-5-17-29/h10-15,20,27-28H,2,4-7,9,16-19,21H2,1H3/t27-,28+/m0/s1 |
| InChIKey | NSJYEZSGGOTGLE-WUFINQPMSA-N |
| XLogP | 5.21 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.59 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|