C30H34F3NO4 — CID 67542836
(3R,4R)-3-[[2-(3-methoxypropyl)phenyl]methoxy]-4-(3-phenylphenyl)piperidine;2,2,2-trifluoroacetic acid (PubChem CID 67542836) has the molecular formula C30H34F3NO4 and a molecular weight of 529.60 g/mol. Its IUPAC name is (3R,4R)-3-[[2-(3-methoxypropyl)phenyl]methoxy]-4-(3-phenylphenyl)piperidine;2,2,2-trifluoroacetic acid.
| Compound Name | (3R,4R)-3-[[2-(3-methoxypropyl)phenyl]methoxy]-4-(3-phenylphenyl)piperidine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 67542836 |
| Molecular Formula | C30H34F3NO4 |
| Molecular Weight | 529.60 g/mol |
| Exact Mass | 529.24 |
| IUPAC Name | (3R,4R)-3-[[2-(3-methoxypropyl)phenyl]methoxy]-4-(3-phenylphenyl)piperidine;2,2,2-trifluoroacetic acid |
| SMILES | COCCCc1ccccc1CO[C@H]1CNCC[C@@H]1c1cccc(-c2ccccc2)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C28H33NO2.C2HF3O2/c1-30-18-8-15-23-11-5-6-12-26(23)21-31-28-20-29-17-16-27(28)25-14-7-13-24(19-25)22-9-3-2-4-10-22;3-2(4,5)1(6)7/h2-7,9-14,19,27-29H,8,15-18,20-21H2,1H3;(H,6,7)/t27-,28+;/m1./s1 |
| InChIKey | DXDIYCATUIDVDL-CNORLSDQSA-N |
| XLogP | 6.23 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.60 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|