C30H31N9O — CID 67543276
3-benzyl-9-[(4-methoxyphenyl)methyl]-6-(4-pyrazin-2-ylpiperazin-1-yl)-2,3,5,7,9-pentazatricyclo[6.3.1.04,12]dodeca-1,4(12),5,7-tetraene (PubChem CID 67543276) has the molecular formula C30H31N9O and a molecular weight of 533.64 g/mol. Its IUPAC name is 3-benzyl-9-[(4-methoxyphenyl)methyl]-6-(4-pyrazin-2-ylpiperazin-1-yl)-2,3,5,7,9-pentazatricyclo[6.3.1.04,12]dodeca-1,4(12),5,7-tetraene.
| Compound Name | 3-benzyl-9-[(4-methoxyphenyl)methyl]-6-(4-pyrazin-2-ylpiperazin-1-yl)-2,3,5,7,9-pentazatricyclo[6.3.1.04,12]dodeca-1,4(12),5,7-tetraene |
|---|---|
| PubChem CID | 67543276 |
| Molecular Formula | C30H31N9O |
| Molecular Weight | 533.64 g/mol |
| Exact Mass | 533.27 |
| IUPAC Name | 3-benzyl-9-[(4-methoxyphenyl)methyl]-6-(4-pyrazin-2-ylpiperazin-1-yl)-2,3,5,7,9-pentazatricyclo[6.3.1.04,12]dodeca-1,4(12),5,7-tetraene |
| SMILES | COc1ccc(CN2CCc3nn(Cc4ccccc4)c4nc(N5CCN(c6cnccn6)CC5)nc2c34)cc1 |
| InChI | InChI=1S/C30H31N9O/c1-40-24-9-7-23(8-10-24)20-38-14-11-25-27-28(38)33-30(34-29(27)39(35-25)21-22-5-3-2-4-6-22)37-17-15-36(16-18-37)26-19-31-12-13-32-26/h2-10,12-13,19H,11,14-18,20-21H2,1H3 |
| InChIKey | PVTKNZNLTBMBFQ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 88.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.64 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |