C21H19Cl3N6O3 — CID 67543381
2-[3-(2,6-dichloroanilino)imidazo[1,2-a]pyrimidin-2-yl]-3,5-dimethoxybenzohydrazide;hydrochloride (PubChem CID 67543381) has the molecular formula C21H19Cl3N6O3 and a molecular weight of 509.78 g/mol. Its IUPAC name is 2-[3-(2,6-dichloroanilino)imidazo[1,2-a]pyrimidin-2-yl]-3,5-dimethoxybenzohydrazide;hydrochloride.
| Compound Name | 2-[3-(2,6-dichloroanilino)imidazo[1,2-a]pyrimidin-2-yl]-3,5-dimethoxybenzohydrazide;hydrochloride |
|---|---|
| PubChem CID | 67543381 |
| Molecular Formula | C21H19Cl3N6O3 |
| Molecular Weight | 509.78 g/mol |
| Exact Mass | 508.06 |
| IUPAC Name | 2-[3-(2,6-dichloroanilino)imidazo[1,2-a]pyrimidin-2-yl]-3,5-dimethoxybenzohydrazide;hydrochloride |
| SMILES | COc1cc(OC)c(-c2nc3ncccn3c2Nc2c(Cl)cccc2Cl)c(C(=O)NN)c1.Cl |
| InChI | InChI=1S/C21H18Cl2N6O3.ClH/c1-31-11-9-12(20(30)28-24)16(15(10-11)32-2)18-19(29-8-4-7-25-21(29)27-18)26-17-13(22)5-3-6-14(17)23;/h3-10,26H,24H2,1-2H3,(H,28,30);1H |
| InChIKey | MEVDPODSGQTQCF-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 115.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.78 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|