C24H25F3N2O — CID 67543713
(1S,12R)-5-methoxy-15-methyl-9-[2-[3-(trifluoromethyl)phenyl]ethyl]-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraene (PubChem CID 67543713) has the molecular formula C24H25F3N2O and a molecular weight of 414.47 g/mol. Its IUPAC name is (1S,12R)-5-methoxy-15-methyl-9-[2-[3-(trifluoromethyl)phenyl]ethyl]-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraene.
| Compound Name | (1S,12R)-5-methoxy-15-methyl-9-[2-[3-(trifluoromethyl)phenyl]ethyl]-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraene |
|---|---|
| PubChem CID | 67543713 |
| Molecular Formula | C24H25F3N2O |
| Molecular Weight | 414.47 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | (1S,12R)-5-methoxy-15-methyl-9-[2-[3-(trifluoromethyl)phenyl]ethyl]-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraene |
| SMILES | COc1ccc2c(c1)c1c(n2CCc2cccc(C(F)(F)F)c2)C[C@H]2CC[C@@H]1N2C |
| InChI | InChI=1S/C24H25F3N2O/c1-28-17-6-8-21(28)23-19-14-18(30-2)7-9-20(19)29(22(23)13-17)11-10-15-4-3-5-16(12-15)24(25,26)27/h3-5,7,9,12,14,17,21H,6,8,10-11,13H2,1-2H3/t17-,21+/m1/s1 |
| InChIKey | VIFSVNQYHVIEJZ-UTKZUKDTSA-N |
| XLogP | 5.60 |
| TPSA | 17.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.47 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|