About phenyl (Z)-4,4,4-trifluoro-N-(2-methylphenyl)-3-phenylsulfanylbut-2-enimidothioate
phenyl (Z)-4,4,4-trifluoro-N-(2-methylphenyl)-3-phenylsulfanylbut-2-enimidothioate (PubChem CID 67543846) has the molecular formula C23H18F3NS2
and a molecular weight of 429.53 g/mol. Its IUPAC name is phenyl (Z)-4,4,4-trifluoro-N-(2-methylphenyl)-3-phenylsulfanylbut-2-enimidothioate.
Molecular Properties
| Compound Name | phenyl (Z)-4,4,4-trifluoro-N-(2-methylphenyl)-3-phenylsulfanylbut-2-enimidothioate |
| PubChem CID | 67543846 |
| Molecular Formula | C23H18F3NS2 |
| Molecular Weight | 429.53 g/mol |
| Exact Mass | 429.08 |
| IUPAC Name | phenyl (Z)-4,4,4-trifluoro-N-(2-methylphenyl)-3-phenylsulfanylbut-2-enimidothioate |
| SMILES | Cc1ccccc1/N=C(/C=C(\Sc1ccccc1)C(F)(F)F)Sc1ccccc1 |
| InChI | InChI=1S/C23H18F3NS2/c1-17-10-8-9-15-20(17)27-22(29-19-13-6-3-7-14-19)16-21(23(24,25)26)28-18-11-4-2-5-12-18/h2-16H,1H3/b21-16-,27-22- |
| InChIKey | PXIYLKVIWGSRDE-GHLMXXQOSA-N |
| XLogP | 8.06 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 429.53 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze phenyl (Z)-4,4,4-trifluoro-N-(2-methylphenyl)-3-phenylsulfanylbut-2-enimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl (Z)-4,4,4-trifluoro-N-(2-methylphenyl)-3-phenylsulfanylbut-2-enimidothioate?
The IUPAC name of phenyl (Z)-4,4,4-trifluoro-N-(2-methylphenyl)-3-phenylsulfanylbut-2-enimidothioate (CID 67543846) is phenyl (Z)-4,4,4-trifluoro-N-(2-methylphenyl)-3-phenylsulfanylbut-2-enimidothioate.
What is the SMILES notation for phenyl (Z)-4,4,4-trifluoro-N-(2-methylphenyl)-3-phenylsulfanylbut-2-enimidothioate?
The canonical SMILES for phenyl (Z)-4,4,4-trifluoro-N-(2-methylphenyl)-3-phenylsulfanylbut-2-enimidothioate is Cc1ccccc1/N=C(/C=C(\Sc1ccccc1)C(F)(F)F)Sc1ccccc1.
What is the InChIKey of phenyl (Z)-4,4,4-trifluoro-N-(2-methylphenyl)-3-phenylsulfanylbut-2-enimidothioate?
The InChIKey is PXIYLKVIWGSRDE-GHLMXXQOSA-N. The full InChI is InChI=1S/C23H18F3NS2/c1-17-10-8-9-15-20(17)27-22(29-19-13-6-3-7-14-19)16-21(23(24,25)26)28-18-11-4-2-5-12-18/h2-16H,1H3/b21-16-,27-22-.
What are the key properties of phenyl (Z)-4,4,4-trifluoro-N-(2-methylphenyl)-3-phenylsulfanylbut-2-enimidothioate?
phenyl (Z)-4,4,4-trifluoro-N-(2-methylphenyl)-3-phenylsulfanylbut-2-enimidothioate has a molecular weight of 429.53 g/mol, XLogP of 8.06, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl (Z)-4,4,4-trifluoro-N-(2-methylphenyl)-3-phenylsulfanylbut-2-enimidothioate is sourced from PubChem (CID 67543846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).