C24H31N3 — CID 67543853
(1S,2R,10S,12R)-7,16-dimethyl-3-[2-(6-methyl-3-pyridinyl)ethyl]-3,16-diazatetracyclo[10.3.1.02,10.04,9]hexadeca-4(9),5,7-triene (PubChem CID 67543853) has the molecular formula C24H31N3 and a molecular weight of 361.53 g/mol. Its IUPAC name is (1S,2R,10S,12R)-7,16-dimethyl-3-[2-(6-methyl-3-pyridinyl)ethyl]-3,16-diazatetracyclo[10.3.1.02,10.04,9]hexadeca-4(9),5,7-triene.
| Compound Name | (1S,2R,10S,12R)-7,16-dimethyl-3-[2-(6-methyl-3-pyridinyl)ethyl]-3,16-diazatetracyclo[10.3.1.02,10.04,9]hexadeca-4(9),5,7-triene |
|---|---|
| PubChem CID | 67543853 |
| Molecular Formula | C24H31N3 |
| Molecular Weight | 361.53 g/mol |
| Exact Mass | 361.25 |
| IUPAC Name | (1S,2R,10S,12R)-7,16-dimethyl-3-[2-(6-methyl-3-pyridinyl)ethyl]-3,16-diazatetracyclo[10.3.1.02,10.04,9]hexadeca-4(9),5,7-triene |
| SMILES | Cc1ccc2c(c1)[C@@H]1C[C@H]3CCC[C@@H]([C@@H]1N2CCc1ccc(C)nc1)N3C |
| InChI | InChI=1S/C24H31N3/c1-16-7-10-22-20(13-16)21-14-19-5-4-6-23(26(19)3)24(21)27(22)12-11-18-9-8-17(2)25-15-18/h7-10,13,15,19,21,23-24H,4-6,11-12,14H2,1-3H3/t19-,21+,23+,24-/m1/s1 |
| InChIKey | MUGGCOHNTJPCMD-BKXMBWNOSA-N |
| XLogP | 4.47 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.53 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |