About (E)-N-phenyl-2,3-bis(phenylsulfanyl)prop-2-enamide
(E)-N-phenyl-2,3-bis(phenylsulfanyl)prop-2-enamide (PubChem CID 67544076) has the molecular formula C21H17NOS2
and a molecular weight of 363.51 g/mol. Its IUPAC name is (E)-N-phenyl-2,3-bis(phenylsulfanyl)prop-2-enamide.
Molecular Properties
| Compound Name | (E)-N-phenyl-2,3-bis(phenylsulfanyl)prop-2-enamide |
| PubChem CID | 67544076 |
| Molecular Formula | C21H17NOS2 |
| Molecular Weight | 363.51 g/mol |
| Exact Mass | 363.08 |
| IUPAC Name | (E)-N-phenyl-2,3-bis(phenylsulfanyl)prop-2-enamide |
| SMILES | O=C(Nc1ccccc1)/C(=C\Sc1ccccc1)Sc1ccccc1 |
| InChI | InChI=1S/C21H17NOS2/c23-21(22-17-10-4-1-5-11-17)20(25-19-14-8-3-9-15-19)16-24-18-12-6-2-7-13-18/h1-16H,(H,22,23)/b20-16+ |
| InChIKey | QUVLAGBJJPOZAI-CAPFRKAQSA-N |
| XLogP | 6.05 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 363.51 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-N-phenyl-2,3-bis(phenylsulfanyl)prop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N-phenyl-2,3-bis(phenylsulfanyl)prop-2-enamide?
The IUPAC name of (E)-N-phenyl-2,3-bis(phenylsulfanyl)prop-2-enamide (CID 67544076) is (E)-N-phenyl-2,3-bis(phenylsulfanyl)prop-2-enamide.
What is the SMILES notation for (E)-N-phenyl-2,3-bis(phenylsulfanyl)prop-2-enamide?
The canonical SMILES for (E)-N-phenyl-2,3-bis(phenylsulfanyl)prop-2-enamide is O=C(Nc1ccccc1)/C(=C\Sc1ccccc1)Sc1ccccc1.
What is the InChIKey of (E)-N-phenyl-2,3-bis(phenylsulfanyl)prop-2-enamide?
The InChIKey is QUVLAGBJJPOZAI-CAPFRKAQSA-N. The full InChI is InChI=1S/C21H17NOS2/c23-21(22-17-10-4-1-5-11-17)20(25-19-14-8-3-9-15-19)16-24-18-12-6-2-7-13-18/h1-16H,(H,22,23)/b20-16+.
What are the key properties of (E)-N-phenyl-2,3-bis(phenylsulfanyl)prop-2-enamide?
(E)-N-phenyl-2,3-bis(phenylsulfanyl)prop-2-enamide has a molecular weight of 363.51 g/mol, XLogP of 6.05, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N-phenyl-2,3-bis(phenylsulfanyl)prop-2-enamide is sourced from PubChem (CID 67544076), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).