About (2-methoxyphenyl) (E)-2-methyl-3-(4-methylphenoxy)-N-phenylprop-2-enimidate
(2-methoxyphenyl) (E)-2-methyl-3-(4-methylphenoxy)-N-phenylprop-2-enimidate (PubChem CID 67544611) has the molecular formula C24H23NO3
and a molecular weight of 373.45 g/mol. Its IUPAC name is (2-methoxyphenyl) (E)-2-methyl-3-(4-methylphenoxy)-N-phenylprop-2-enimidate.
Molecular Properties
| Compound Name | (2-methoxyphenyl) (E)-2-methyl-3-(4-methylphenoxy)-N-phenylprop-2-enimidate |
| PubChem CID | 67544611 |
| Molecular Formula | C24H23NO3 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | (2-methoxyphenyl) (E)-2-methyl-3-(4-methylphenoxy)-N-phenylprop-2-enimidate |
| SMILES | COc1ccccc1OC(=N/c1ccccc1)/C(C)=C/Oc1ccc(C)cc1 |
| InChI | InChI=1S/C24H23NO3/c1-18-13-15-21(16-14-18)27-17-19(2)24(25-20-9-5-4-6-10-20)28-23-12-8-7-11-22(23)26-3/h4-17H,1-3H3/b19-17+,25-24+ |
| InChIKey | KROYTIAMUWCYAW-AIHZIKAQSA-N |
| XLogP | 6.10 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (2-methoxyphenyl) (E)-2-methyl-3-(4-methylphenoxy)-N-phenylprop-2-enimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methoxyphenyl) (E)-2-methyl-3-(4-methylphenoxy)-N-phenylprop-2-enimidate?
The IUPAC name of (2-methoxyphenyl) (E)-2-methyl-3-(4-methylphenoxy)-N-phenylprop-2-enimidate (CID 67544611) is (2-methoxyphenyl) (E)-2-methyl-3-(4-methylphenoxy)-N-phenylprop-2-enimidate.
What is the SMILES notation for (2-methoxyphenyl) (E)-2-methyl-3-(4-methylphenoxy)-N-phenylprop-2-enimidate?
The canonical SMILES for (2-methoxyphenyl) (E)-2-methyl-3-(4-methylphenoxy)-N-phenylprop-2-enimidate is COc1ccccc1OC(=N/c1ccccc1)/C(C)=C/Oc1ccc(C)cc1.
What is the InChIKey of (2-methoxyphenyl) (E)-2-methyl-3-(4-methylphenoxy)-N-phenylprop-2-enimidate?
The InChIKey is KROYTIAMUWCYAW-AIHZIKAQSA-N. The full InChI is InChI=1S/C24H23NO3/c1-18-13-15-21(16-14-18)27-17-19(2)24(25-20-9-5-4-6-10-20)28-23-12-8-7-11-22(23)26-3/h4-17H,1-3H3/b19-17+,25-24+.
What are the key properties of (2-methoxyphenyl) (E)-2-methyl-3-(4-methylphenoxy)-N-phenylprop-2-enimidate?
(2-methoxyphenyl) (E)-2-methyl-3-(4-methylphenoxy)-N-phenylprop-2-enimidate has a molecular weight of 373.45 g/mol, XLogP of 6.10, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methoxyphenyl) (E)-2-methyl-3-(4-methylphenoxy)-N-phenylprop-2-enimidate is sourced from PubChem (CID 67544611), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).