C28H47ClN6O4 — CID 67544760
4-amino-N-tert-butyl-5-oxo-3-propan-2-yl-1,2,4-triazole-1-carboxamide;N-(butoxymethyl)-N-(2-tert-butyl-6-methylphenyl)-2-chloroacetamide (PubChem CID 67544760) has the molecular formula C28H47ClN6O4 and a molecular weight of 567.18 g/mol. Its IUPAC name is 4-amino-N-tert-butyl-5-oxo-3-propan-2-yl-1,2,4-triazole-1-carboxamide;N-(butoxymethyl)-N-(2-tert-butyl-6-methylphenyl)-2-chloroacetamide.
| Compound Name | 4-amino-N-tert-butyl-5-oxo-3-propan-2-yl-1,2,4-triazole-1-carboxamide;N-(butoxymethyl)-N-(2-tert-butyl-6-methylphenyl)-2-chloroacetamide |
|---|---|
| PubChem CID | 67544760 |
| Molecular Formula | C28H47ClN6O4 |
| Molecular Weight | 567.18 g/mol |
| Exact Mass | 566.33 |
| IUPAC Name | 4-amino-N-tert-butyl-5-oxo-3-propan-2-yl-1,2,4-triazole-1-carboxamide;N-(butoxymethyl)-N-(2-tert-butyl-6-methylphenyl)-2-chloroacetamide |
| SMILES | CC(C)c1nn(C(=O)NC(C)(C)C)c(=O)n1N.CCCCOCN(C(=O)CCl)c1c(C)cccc1C(C)(C)C |
| InChI | InChI=1S/C18H28ClNO2.C10H19N5O2/c1-6-7-11-22-13-20(16(21)12-19)17-14(2)9-8-10-15(17)18(3,4)5;1-6(2)7-13-15(9(17)14(7)11)8(16)12-10(3,4)5/h8-10H,6-7,11-13H2,1-5H3;6H,11H2,1-5H3,(H,12,16) |
| InChIKey | ZGWNXTUTOPPBDY-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 124.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.18 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|