C16H24Br2N4O4S2 — CID 67545365
diethyl 4,6-bis(carbamimidoylsulfanylmethyl)benzene-1,3-dicarboxylate;dihydrobromide (PubChem CID 67545365) has the molecular formula C16H24Br2N4O4S2 and a molecular weight of 560.33 g/mol. Its IUPAC name is diethyl 4,6-bis(carbamimidoylsulfanylmethyl)benzene-1,3-dicarboxylate;dihydrobromide.
| Compound Name | diethyl 4,6-bis(carbamimidoylsulfanylmethyl)benzene-1,3-dicarboxylate;dihydrobromide |
|---|---|
| PubChem CID | 67545365 |
| Molecular Formula | C16H24Br2N4O4S2 |
| Molecular Weight | 560.33 g/mol |
| Exact Mass | 557.96 |
| IUPAC Name | diethyl 4,6-bis(carbamimidoylsulfanylmethyl)benzene-1,3-dicarboxylate;dihydrobromide |
| SMILES | Br.Br.[H]/N=C(\N)SCc1cc(CS/C(N)=N/[H])c(C(=O)OCC)cc1C(=O)OCC |
| InChI | InChI=1S/C16H22N4O4S2.2BrH/c1-3-23-13(21)11-6-12(14(22)24-4-2)10(8-26-16(19)20)5-9(11)7-25-15(17)18;;/h5-6H,3-4,7-8H2,1-2H3,(H3,17,18)(H3,19,20);2*1H |
| InChIKey | IJQALTPHFMDQRZ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 152.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.33 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|