C23H22ClF3N2O — CID 67545513
9-[2-(4-chlorophenyl)ethyl]-15-methyl-5-(trifluoromethoxy)-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraene (PubChem CID 67545513) has the molecular formula C23H22ClF3N2O and a molecular weight of 434.89 g/mol. Its IUPAC name is 9-[2-(4-chlorophenyl)ethyl]-15-methyl-5-(trifluoromethoxy)-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraene.
| Compound Name | 9-[2-(4-chlorophenyl)ethyl]-15-methyl-5-(trifluoromethoxy)-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraene |
|---|---|
| PubChem CID | 67545513 |
| Molecular Formula | C23H22ClF3N2O |
| Molecular Weight | 434.89 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | 9-[2-(4-chlorophenyl)ethyl]-15-methyl-5-(trifluoromethoxy)-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraene |
| SMILES | CN1C2CCC1c1c(n(CCc3ccc(Cl)cc3)c3ccc(OC(F)(F)F)cc13)C2 |
| InChI | InChI=1S/C23H22ClF3N2O/c1-28-16-6-8-20(28)22-18-13-17(30-23(25,26)27)7-9-19(18)29(21(22)12-16)11-10-14-2-4-15(24)5-3-14/h2-5,7,9,13,16,20H,6,8,10-12H2,1H3 |
| InChIKey | AHLYSJPXVPVDGW-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 17.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.89 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|