About methyl (1R)-1-amino-2,3-dihydro-1H-indene-5-carboxylate;hydrochloride
methyl (1R)-1-amino-2,3-dihydro-1H-indene-5-carboxylate;hydrochloride (PubChem CID 67546135) has the molecular formula C11H14ClNO2
and a molecular weight of 227.69 g/mol. Its IUPAC name is methyl (1R)-1-amino-2,3-dihydro-1H-indene-5-carboxylate;hydrochloride.
Molecular Properties
| Compound Name | methyl (1R)-1-amino-2,3-dihydro-1H-indene-5-carboxylate;hydrochloride |
| PubChem CID | 67546135 |
| Molecular Formula | C11H14ClNO2 |
| Molecular Weight | 227.69 g/mol |
| Exact Mass | 227.07 |
| IUPAC Name | methyl (1R)-1-amino-2,3-dihydro-1H-indene-5-carboxylate;hydrochloride |
| SMILES | COC(=O)c1ccc2c(c1)CC[C@H]2N.Cl |
| InChI | InChI=1S/C11H13NO2.ClH/c1-14-11(13)8-2-4-9-7(6-8)3-5-10(9)12;/h2,4,6,10H,3,5,12H2,1H3;1H/t10-;/m1./s1 |
| InChIKey | UOZGMHAMWDHRQO-HNCPQSOCSA-N |
| XLogP | 1.84 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.69 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl (1R)-1-amino-2,3-dihydro-1H-indene-5-carboxylate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (1R)-1-amino-2,3-dihydro-1H-indene-5-carboxylate;hydrochloride?
The IUPAC name of methyl (1R)-1-amino-2,3-dihydro-1H-indene-5-carboxylate;hydrochloride (CID 67546135) is methyl (1R)-1-amino-2,3-dihydro-1H-indene-5-carboxylate;hydrochloride.
What is the SMILES notation for methyl (1R)-1-amino-2,3-dihydro-1H-indene-5-carboxylate;hydrochloride?
The canonical SMILES for methyl (1R)-1-amino-2,3-dihydro-1H-indene-5-carboxylate;hydrochloride is COC(=O)c1ccc2c(c1)CC[C@H]2N.Cl.
What is the InChIKey of methyl (1R)-1-amino-2,3-dihydro-1H-indene-5-carboxylate;hydrochloride?
The InChIKey is UOZGMHAMWDHRQO-HNCPQSOCSA-N. The full InChI is InChI=1S/C11H13NO2.ClH/c1-14-11(13)8-2-4-9-7(6-8)3-5-10(9)12;/h2,4,6,10H,3,5,12H2,1H3;1H/t10-;/m1./s1.
What are the key properties of methyl (1R)-1-amino-2,3-dihydro-1H-indene-5-carboxylate;hydrochloride?
methyl (1R)-1-amino-2,3-dihydro-1H-indene-5-carboxylate;hydrochloride has a molecular weight of 227.69 g/mol, XLogP of 1.84, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (1R)-1-amino-2,3-dihydro-1H-indene-5-carboxylate;hydrochloride is sourced from PubChem (CID 67546135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).