C29H28F3N3O2S — CID 67546574
5-methyl-9-[2-(6-methyl-3-pyridinyl)ethyl]-15-[4-(trifluoromethyl)phenyl]sulfonyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraene (PubChem CID 67546574) has the molecular formula C29H28F3N3O2S and a molecular weight of 539.62 g/mol. Its IUPAC name is 5-methyl-9-[2-(6-methyl-3-pyridinyl)ethyl]-15-[4-(trifluoromethyl)phenyl]sulfonyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraene.
| Compound Name | 5-methyl-9-[2-(6-methyl-3-pyridinyl)ethyl]-15-[4-(trifluoromethyl)phenyl]sulfonyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraene |
|---|---|
| PubChem CID | 67546574 |
| Molecular Formula | C29H28F3N3O2S |
| Molecular Weight | 539.62 g/mol |
| Exact Mass | 539.19 |
| IUPAC Name | 5-methyl-9-[2-(6-methyl-3-pyridinyl)ethyl]-15-[4-(trifluoromethyl)phenyl]sulfonyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraene |
| SMILES | Cc1ccc2c(c1)c1c(n2CCc2ccc(C)nc2)CC2CCC1N2S(=O)(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C29H28F3N3O2S/c1-18-3-11-25-24(15-18)28-26-12-8-22(16-27(28)34(25)14-13-20-5-4-19(2)33-17-20)35(26)38(36,37)23-9-6-21(7-10-23)29(30,31)32/h3-7,9-11,15,17,22,26H,8,12-14,16H2,1-2H3 |
| InChIKey | UVTQCDZAQWAXJZ-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.62 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|