C22H30N2O — CID 6754677
N-[[(2R,3R,8aS)-3,8,8-trimethyl-2,3,4,6,7,8a-hexahydro-1H-naphthalen-2-yl]methylideneamino]-2-phenylacetamide (PubChem CID 6754677) has the molecular formula C22H30N2O and a molecular weight of 338.50 g/mol. Its IUPAC name is N-[[(2R,3R,8aS)-3,8,8-trimethyl-2,3,4,6,7,8a-hexahydro-1H-naphthalen-2-yl]methylideneamino]-2-phenylacetamide.
| Compound Name | N-[[(2R,3R,8aS)-3,8,8-trimethyl-2,3,4,6,7,8a-hexahydro-1H-naphthalen-2-yl]methylideneamino]-2-phenylacetamide |
|---|---|
| PubChem CID | 6754677 |
| Molecular Formula | C22H30N2O |
| Molecular Weight | 338.50 g/mol |
| Exact Mass | 338.24 |
| IUPAC Name | N-[[(2R,3R,8aS)-3,8,8-trimethyl-2,3,4,6,7,8a-hexahydro-1H-naphthalen-2-yl]methylideneamino]-2-phenylacetamide |
| SMILES | C[C@@H]1CC2=CCCC(C)(C)[C@@H]2C[C@H]1C=NNC(=O)Cc1ccccc1 |
| InChI | InChI=1S/C22H30N2O/c1-16-12-18-10-7-11-22(2,3)20(18)14-19(16)15-23-24-21(25)13-17-8-5-4-6-9-17/h4-6,8-10,15-16,19-20H,7,11-14H2,1-3H3,(H,24,25)/t16-,19+,20-/m1/s1 |
| InChIKey | PAMWSKDSAYOAOC-LSTHTHJFSA-N |
| XLogP | 4.74 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.50 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|