C9H12N4O3 — CID 67546830
1,3,4,9-tetramethylpurine-2,6,8-trione (PubChem CID 67546830) has the molecular formula C9H12N4O3 and a molecular weight of 224.22 g/mol. Its IUPAC name is 1,3,4,9-tetramethylpurine-2,6,8-trione.
| Compound Name | 1,3,4,9-tetramethylpurine-2,6,8-trione |
|---|---|
| PubChem CID | 67546830 |
| Molecular Formula | C9H12N4O3 |
| Molecular Weight | 224.22 g/mol |
| Exact Mass | 224.09 |
| IUPAC Name | 1,3,4,9-tetramethylpurine-2,6,8-trione |
| SMILES | CN1C(=O)C2=NC(=O)N(C)C2(C)N(C)C1=O |
| InChI | InChI=1S/C9H12N4O3/c1-9-5(10-7(15)12(9)3)6(14)11(2)8(16)13(9)4/h1-4H3 |
| InChIKey | RZYMKNOLNJDCMT-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 73.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.22 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |