C16H12N2 — CID 67547862
6,13-dimethyl-5,7-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),2,4,6,8(16),9,11(15),12-octaene (PubChem CID 67547862) has the molecular formula C16H12N2 and a molecular weight of 232.29 g/mol. Its IUPAC name is 6,13-dimethyl-5,7-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),2,4,6,8(16),9,11(15),12-octaene.
| Compound Name | 6,13-dimethyl-5,7-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),2,4,6,8(16),9,11(15),12-octaene |
|---|---|
| PubChem CID | 67547862 |
| Molecular Formula | C16H12N2 |
| Molecular Weight | 232.29 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | 6,13-dimethyl-5,7-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),2,4,6,8(16),9,11(15),12-octaene |
| SMILES | Cc1cc2ccc3nc(C)nc4ccc(c1)c2c34 |
| InChI | InChI=1S/C16H12N2/c1-9-7-11-3-5-13-16-14(18-10(2)17-13)6-4-12(8-9)15(11)16/h3-8H,1-2H3 |
| InChIKey | YJWGUOSMJDCSQR-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.29 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'naphth_amino_A(25)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|