C17H13FN4 — CID 67548041
2-(4-fluorophenyl)-N-methylimidazo[1,2-a]quinoxalin-4-amine (PubChem CID 67548041) has the molecular formula C17H13FN4 and a molecular weight of 292.32 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-N-methylimidazo[1,2-a]quinoxalin-4-amine.
| Compound Name | 2-(4-fluorophenyl)-N-methylimidazo[1,2-a]quinoxalin-4-amine |
|---|---|
| PubChem CID | 67548041 |
| Molecular Formula | C17H13FN4 |
| Molecular Weight | 292.32 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | 2-(4-fluorophenyl)-N-methylimidazo[1,2-a]quinoxalin-4-amine |
| SMILES | CNc1nc2ccccc2n2cc(-c3ccc(F)cc3)nc12 |
| InChI | InChI=1S/C17H13FN4/c1-19-16-17-21-14(11-6-8-12(18)9-7-11)10-22(17)15-5-3-2-4-13(15)20-16/h2-10H,1H3,(H,19,20) |
| InChIKey | LBTKGWRJVCGRIJ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 42.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.32 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |