About 5-butyl-2-propan-2-yl-1,3-thiazole
5-butyl-2-propan-2-yl-1,3-thiazole (PubChem CID 67548317) has the molecular formula C10H17NS
and a molecular weight of 183.32 g/mol. Its IUPAC name is 5-butyl-2-propan-2-yl-1,3-thiazole.
Molecular Properties
| Compound Name | 5-butyl-2-propan-2-yl-1,3-thiazole |
| PubChem CID | 67548317 |
| Molecular Formula | C10H17NS |
| Molecular Weight | 183.32 g/mol |
| Exact Mass | 183.11 |
| IUPAC Name | 5-butyl-2-propan-2-yl-1,3-thiazole |
| SMILES | CCCCc1cnc(C(C)C)s1 |
| InChI | InChI=1S/C10H17NS/c1-4-5-6-9-7-11-10(12-9)8(2)3/h7-8H,4-6H2,1-3H3 |
| InChIKey | BUQNEBBMARCFGE-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.32 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-butyl-2-propan-2-yl-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-butyl-2-propan-2-yl-1,3-thiazole?
The IUPAC name of 5-butyl-2-propan-2-yl-1,3-thiazole (CID 67548317) is 5-butyl-2-propan-2-yl-1,3-thiazole.
What is the SMILES notation for 5-butyl-2-propan-2-yl-1,3-thiazole?
The canonical SMILES for 5-butyl-2-propan-2-yl-1,3-thiazole is CCCCc1cnc(C(C)C)s1.
What is the InChIKey of 5-butyl-2-propan-2-yl-1,3-thiazole?
The InChIKey is BUQNEBBMARCFGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NS/c1-4-5-6-9-7-11-10(12-9)8(2)3/h7-8H,4-6H2,1-3H3.
What are the key properties of 5-butyl-2-propan-2-yl-1,3-thiazole?
5-butyl-2-propan-2-yl-1,3-thiazole has a molecular weight of 183.32 g/mol, XLogP of 3.61, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-butyl-2-propan-2-yl-1,3-thiazole is sourced from PubChem (CID 67548317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).