C9H3N5O2 — CID 67548329
pyrimido[4,5-g][1,2,3]benzotriazine-4,9-dione (PubChem CID 67548329) has the molecular formula C9H3N5O2 and a molecular weight of 213.16 g/mol. Its IUPAC name is pyrimido[4,5-g][1,2,3]benzotriazine-4,9-dione.
| Compound Name | pyrimido[4,5-g][1,2,3]benzotriazine-4,9-dione |
|---|---|
| PubChem CID | 67548329 |
| Molecular Formula | C9H3N5O2 |
| Molecular Weight | 213.16 g/mol |
| Exact Mass | 213.03 |
| IUPAC Name | pyrimido[4,5-g][1,2,3]benzotriazine-4,9-dione |
| SMILES | O=C1N=CN=c2cc3c(cc21)=NN=NC3=O |
| InChI | InChI=1S/C9H3N5O2/c15-8-4-2-7-5(9(16)13-14-12-7)1-6(4)10-3-11-8/h1-3H |
| InChIKey | HEDKAQJGFLUQSZ-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 95.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.16 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|