C30H58O3 — CID 67548515
2-(2,3,3,4,4,5-hexamethylhexan-2-yl)-2-[2-(2,3,3,4,4,5-hexamethylhexan-2-yl)oxetan-2-yl]oxyoxetane (PubChem CID 67548515) has the molecular formula C30H58O3 and a molecular weight of 466.79 g/mol. Its IUPAC name is 2-(2,3,3,4,4,5-hexamethylhexan-2-yl)-2-[2-(2,3,3,4,4,5-hexamethylhexan-2-yl)oxetan-2-yl]oxyoxetane.
| Compound Name | 2-(2,3,3,4,4,5-hexamethylhexan-2-yl)-2-[2-(2,3,3,4,4,5-hexamethylhexan-2-yl)oxetan-2-yl]oxyoxetane |
|---|---|
| PubChem CID | 67548515 |
| Molecular Formula | C30H58O3 |
| Molecular Weight | 466.79 g/mol |
| Exact Mass | 466.44 |
| IUPAC Name | 2-(2,3,3,4,4,5-hexamethylhexan-2-yl)-2-[2-(2,3,3,4,4,5-hexamethylhexan-2-yl)oxetan-2-yl]oxyoxetane |
| SMILES | CC(C)C(C)(C)C(C)(C)C(C)(C)C1(OC2(C(C)(C)C(C)(C)C(C)(C)C(C)C)CCO2)CCO1 |
| InChI | InChI=1S/C30H58O3/c1-21(2)23(5,6)25(9,10)27(13,14)29(17-19-31-29)33-30(18-20-32-30)28(15,16)26(11,12)24(7,8)22(3)4/h21-22H,17-20H2,1-16H3 |
| InChIKey | FTPQDRUBNXNQAO-UHFFFAOYSA-N |
| XLogP | 8.71 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.79 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |