About ethyl 4-methyl-2-[4-(propylamino)piperidin-1-yl]-1,3-thiazole-5-carboxylate
ethyl 4-methyl-2-[4-(propylamino)piperidin-1-yl]-1,3-thiazole-5-carboxylate (PubChem CID 67548912) has the molecular formula C15H25N3O2S
and a molecular weight of 311.45 g/mol. Its IUPAC name is ethyl 4-methyl-2-[4-(propylamino)piperidin-1-yl]-1,3-thiazole-5-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-methyl-2-[4-(propylamino)piperidin-1-yl]-1,3-thiazole-5-carboxylate |
| PubChem CID | 67548912 |
| Molecular Formula | C15H25N3O2S |
| Molecular Weight | 311.45 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | ethyl 4-methyl-2-[4-(propylamino)piperidin-1-yl]-1,3-thiazole-5-carboxylate |
| SMILES | CCCNC1CCN(c2nc(C)c(C(=O)OCC)s2)CC1 |
| InChI | InChI=1S/C15H25N3O2S/c1-4-8-16-12-6-9-18(10-7-12)15-17-11(3)13(21-15)14(19)20-5-2/h12,16H,4-10H2,1-3H3 |
| InChIKey | SVPXIKBMIJBFJX-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.45 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 4-methyl-2-[4-(propylamino)piperidin-1-yl]-1,3-thiazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-methyl-2-[4-(propylamino)piperidin-1-yl]-1,3-thiazole-5-carboxylate?
The IUPAC name of ethyl 4-methyl-2-[4-(propylamino)piperidin-1-yl]-1,3-thiazole-5-carboxylate (CID 67548912) is ethyl 4-methyl-2-[4-(propylamino)piperidin-1-yl]-1,3-thiazole-5-carboxylate.
What is the SMILES notation for ethyl 4-methyl-2-[4-(propylamino)piperidin-1-yl]-1,3-thiazole-5-carboxylate?
The canonical SMILES for ethyl 4-methyl-2-[4-(propylamino)piperidin-1-yl]-1,3-thiazole-5-carboxylate is CCCNC1CCN(c2nc(C)c(C(=O)OCC)s2)CC1.
What is the InChIKey of ethyl 4-methyl-2-[4-(propylamino)piperidin-1-yl]-1,3-thiazole-5-carboxylate?
The InChIKey is SVPXIKBMIJBFJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25N3O2S/c1-4-8-16-12-6-9-18(10-7-12)15-17-11(3)13(21-15)14(19)20-5-2/h12,16H,4-10H2,1-3H3.
What are the key properties of ethyl 4-methyl-2-[4-(propylamino)piperidin-1-yl]-1,3-thiazole-5-carboxylate?
ethyl 4-methyl-2-[4-(propylamino)piperidin-1-yl]-1,3-thiazole-5-carboxylate has a molecular weight of 311.45 g/mol, XLogP of 2.60, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-methyl-2-[4-(propylamino)piperidin-1-yl]-1,3-thiazole-5-carboxylate is sourced from PubChem (CID 67548912), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).