About 3-but-2-enoxy-4,4-dimethoxypiperidine-1-carboxylic acid
3-but-2-enoxy-4,4-dimethoxypiperidine-1-carboxylic acid (PubChem CID 67549183) has the molecular formula C12H21NO5
and a molecular weight of 259.30 g/mol. Its IUPAC name is 3-but-2-enoxy-4,4-dimethoxypiperidine-1-carboxylic acid.
Molecular Properties
| Compound Name | 3-but-2-enoxy-4,4-dimethoxypiperidine-1-carboxylic acid |
| PubChem CID | 67549183 |
| Molecular Formula | C12H21NO5 |
| Molecular Weight | 259.30 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | 3-but-2-enoxy-4,4-dimethoxypiperidine-1-carboxylic acid |
| SMILES | CC=CCOC1CN(C(=O)O)CCC1(OC)OC |
| InChI | InChI=1S/C12H21NO5/c1-4-5-8-18-10-9-13(11(14)15)7-6-12(10,16-2)17-3/h4-5,10H,6-9H2,1-3H3,(H,14,15) |
| InChIKey | BVQNYVBVPKTSPP-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.30 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-but-2-enoxy-4,4-dimethoxypiperidine-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-but-2-enoxy-4,4-dimethoxypiperidine-1-carboxylic acid?
The IUPAC name of 3-but-2-enoxy-4,4-dimethoxypiperidine-1-carboxylic acid (CID 67549183) is 3-but-2-enoxy-4,4-dimethoxypiperidine-1-carboxylic acid.
What is the SMILES notation for 3-but-2-enoxy-4,4-dimethoxypiperidine-1-carboxylic acid?
The canonical SMILES for 3-but-2-enoxy-4,4-dimethoxypiperidine-1-carboxylic acid is CC=CCOC1CN(C(=O)O)CCC1(OC)OC.
What is the InChIKey of 3-but-2-enoxy-4,4-dimethoxypiperidine-1-carboxylic acid?
The InChIKey is BVQNYVBVPKTSPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21NO5/c1-4-5-8-18-10-9-13(11(14)15)7-6-12(10,16-2)17-3/h4-5,10H,6-9H2,1-3H3,(H,14,15).
What are the key properties of 3-but-2-enoxy-4,4-dimethoxypiperidine-1-carboxylic acid?
3-but-2-enoxy-4,4-dimethoxypiperidine-1-carboxylic acid has a molecular weight of 259.30 g/mol, XLogP of 1.32, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-but-2-enoxy-4,4-dimethoxypiperidine-1-carboxylic acid is sourced from PubChem (CID 67549183), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).